ألانين (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
L-alanine-skeletal.svg L-alanine-3D-sticks.png
معلومات عامة
Width setter.gif
صيغة كيميائية: C3H7NO2 
وزن جزيئي: 89.1 غ·مول-1
تسمية IUPAC:
(S)-2-aminopropanoic acid
مختصرات: A, Ala
مرادفات:
2-aminopropanoic acid
{α/2}-aminopropionic acid
AIDS{-}071780
HSDB 1801
NSC 206315
بيانات قاعدة البيانات
SMILES: N[C@@]([H])(C)C(O)=O
InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
 رمز ATC: غير موجود  CAS: 338-69-2 (D), 56-41-7 (L)  دروجبانك: غير موجود  رقم EINECS:
206-418-1 (D)[1], 200-273-8 (L)[2]
 بوبكيم: 602 (D)[3], 5950 (L)[4]
خواص فيزيائية
التركيب
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
NMR
MS
تصرف الحالة
خواص الصلب
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -2.912 pI: 6.00 pKa: 2.33, 9.71 تاوتومير: ? رابطة هيدروجينية: متبرع - 2;   مستقبل - 3;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


References[عدل]

  1. a  206-418-1 EINECS for D-alanine
  2. a  200-273-8 EINECS for L-alanine
  3. a  بوبكيم 602
  4. a  بوبكيم 5950