تريبتوفان (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
L-tryptophan-skeletal.png L-tryptophan-3D-sticks.png
معلومات عامة
Width setter.gif
صيغة كيميائية: C11H11N2O2 
وزن جزيئي: 204.23 غ·مول-1
تسمية IUPAC:
(S)-2-Amino-3-(1H-indol-3-yl)-propanoic acid
مختصرات: W, Trp
مرادفات:
لا يوجد
بيانات قاعدة البيانات
SMILES: C(N)(C(=O)O)CC1c2ccccc2NC=1
InChI=1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1/f/h14H 1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
 رمز ATC: غير موجود  CAS: 73-22-3  دروجبانك: غير موجود  رقم EINECS:
200-795-6 [1]
 بوبكيم: 9060 (D)[2], 6305 (L)[3]
خواص فيزيائية
التركيب
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
NMR
MS
تصرف الحالة
خواص الصلب
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -1.677 pI: 5.89 pKa: 2.38, 9.34 تاوتومير: ? رابطة هيدروجينية: متبرع - 3;   مستقبل - 4;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


مصادر[عدل]

  1. a  73-22-3 EINECS for Tryptophan
  2. a  بوبكيم 9060
  3. a  بوبكيم 6305