جلوتامين (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
Chemical structure of GlutamineChemical structure of the amino acid glutamine
معلومات عامة
Width setter.gif
صيغة كيميائية: C5H10N2O3 
وزن جزيئي: 146.15 غ·مول-1
تسمية IUPAC:
(2S)-2-amino-4-carbamoyl-butanoic acid
مختصرات: Q, Gln
مرادفات:
{γ/+/-/D/L}-Glutamine
2-amino-4-carbamoylbutanoic acid
{L-/D-}2-aminoglutaramic acid
AI3-32686
C00303
Cebrogen
G107
Glumin
Glutamic acid {5-/γ-} amide
{L-/D-}glutamid
Miglu-P
NSC 97925
NSC27421
بيانات قاعدة البيانات
SMILES: NC(=O)CCC(N)C(=O)O
InChI=1/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/f/h9H,7H2
 رمز ATC: غير موجود  CAS: [56-85-9]  دروجبانك: غير موجود  رقم EINECS: 200-292-1  بوبكيم:
738 [1], 145815 (D)[2], 5961 (L)[3]
خواص فيزيائية
التركيب
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
NMR
MS
تصرف الحالة
خواص الصلب
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -4.102 pI: 5.65 pKa: 2.18; 9.00 تاوتومير: 2 رابطة هيدروجينية: متبرع - 3;   مستقبل - 4;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


مصادر[عدل]

  1. a  CID 738 من بوبكيم (Gln)
  2. a  CID 145815 من بوبكيم (D)
  3. a  CID 5961 من بوبكيم (L)