حمض الجلوتاميك (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
Chemical structure of Glutamic acidChemical structure of the amino acid glutamate
معلومات عامة
Width setter.gif
صيغة كيميائية: C5H9NO4 
وزن جزيئي: 147.13 غ·مول-1
تسمية IUPAC:
(2S)-2-aminopentanedioic acid
مختصرات: E, Glu
مرادفات:
2-amino-glutaric acid
Glutacid
Glutaminic acid
بيانات قاعدة البيانات
SMILES: OC(=O)CCC(N)C(=O)O
InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/f/h7,9H - (L)
 رمز ATC: غير موجود  CAS: [56-86-0]  دروجبانك: غير موجود  رقم EINECS: 200-293-7  بوبكيم: 23327 (D) [1], 33032 (L) [2]
خواص فيزيائية
التركيب
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
NMR
MS
تصرف الحالة
خواص الصلب
كثافة الصلب: 1.538 غ.سم-3
درجة الذوبان: 247-249 °C
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -3.386 pI: 3.22 pKa: 2.16, 4.15, 9.58 تاوتومير: 0 رابطة هيدروجينية: متبرع - 3;   مستقبل - 5;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


References[عدل]

  1. a  CID 23327 من بوبكيم (D-glutamic acid)
  2. a  CID 33032 من بوبكيم (L-glutamic acid)