أتازانافير

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث

{{صندوق دواء | Verifiedfields = changed | verifiedrevid = 458476502 | IUPAC_name = methyl N-[(1S)-1-{[(2S,3S)-3-hydroxy-4-[(2S)-2-[(methoxycarbonyl)amino]-3,3-dimethyl-N'-{[4-(pyridin-2-yl)phenyl]methyl}butanehydrazido]-1-phenylbutan-2-yl]carbamoyl}-2,2-dimethylpropyl]carbamate | image = Atazanavir-skeletal.svg | width = 280 | image2 = Atazanavir ball-and-stick.png

| tradename = | Drugs.com = monograph | MedlinePlus = a603019 | pregnancy_AU = B2 | pregnancy_US = B | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Oral

| bioavailability = 60-68% | protein_bound = 86% | metabolism = كبد (سيتوكروم 3A4-mediated) | elimination_half-life = 6.5 hours | excretion = Fecal and Renal

| CASNo_Ref =  Yes Check Circle.svg | CAS_number_Ref =  Yes Check Circle.svg | CAS_number = 198904-31-3 | ATC_prefix = J05 | ATC_suffix = AE08 | ATC_supplemental = | PubChem = 148192 | DrugBank_Ref =  Yes Check Circle.svg | DrugBank = DB01072 | ChemSpiderID_Ref =  Yes Check Circle.svg | ChemSpiderID = 130642 | UNII_Ref =  Yes Check Circle.svg | UNII = QZU4H47A3S | KEGG_Ref =  N | KEGG = D01276 | ChEBI_Ref =  Yes Check Circle.svg | ChEBI = 37924 | ChEMBL_Ref =  Yes Check Circle.svg | ChEMBL = 1163 | NIAID_ChemDB = 057755

| C=38 | H=52 | N=6 | O=7 | molecular_weight = 704.856 g/mol | smiles = O=C(OC)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)Cc3ccc(c2ncccc2)cc3)C(C)(C)C | InChI = 1/C38H52N6O7/c1-37(2,3)31(41-35(48)50-7)33(46)40-29(22-25-14-10-9-11-15-25)30(45)24-44(43-34(47)32(38(4,5)6)42-36(49)51-8)23-26-17-19-27(20-18-26)28-16-12-13-21-39-28/h9-21,29-32,45H,22-24H2,1-8H3,(H,40,46)(H,41,48)(H,42,49)(H,43,47)/t29-,30-,31+,32+/m0/s1 | InChIKey = AXRYRYVKAWYZBR-GASGPIRDBE | StdInChI_Ref =  Yes Check Circle.svg | StdInChI = 1S/C38H52N6O7/c1-37(2,3)31(41-35(48)50-7)33(46)40-29(22-25-14-10-9-11-15-25)30(45)24-44(43-34(47)32(38(4,5)6)42-36(49)51-8)23-26-17-19-27(20-18-26)28-16-12-13-21-39-28/h9-21,29-32,45H,22-24H2,1-8H3,(H,40,46)(H,41,48)(H,42,49)(H,43,47)/t29-,30-,31+,32+/m0/s1 | StdInChIKey_Ref =  Yes Check Circle.svg | StdInChIKey = AXRYRYVKAWYZBR-GASGPIRDSA-N }}

كبسولتي رياتاز 200 ملغ

أتازانافير[1] هو دواء تسوقه بريستول مايرز سكويب تحت اسم تجاري هو رياتاز (Reyataz)، وهو أحد مضادات الفيروسات القهقرية من مجموعة مثبطات البروتياز. يستخدم لعلاج عدوى فيروس العوز المناعي البشري.

رخصت إدارة الغذاء والدواء استخدامه بتاريخ 20 حزيران 2003. وفي 29 كانون الثاني 2015، رخصت إدارة الغذاء والدواء استخدام إيفوتاز، وهو دواء مركب ثابت الجرعة مكون من أتازانافير وكوبيسيستات.

وهو أحد الأدوية المدرجة في قائمة منظمة الصحة العالمية للأدوية الأساسية.[2]

المصادر[عدل]

  1. ^ "Atazanavir". مدلاين بلس. معاهد الصحة الوطنية الأمريكية. October 15, 2012. اطلع عليه بتاريخ August 3, 2013. 
  2. ^ "WHO Model List of EssentialMedicines" (PDF). World Health Organization. October 2013. اطلع عليه بتاريخ 22 April 2014. 
Bowl Of Hygieia by David.svg
هذه بذرة مقالة عن الصيدلة بحاجة للتوسيع. شارك في تحريرها.