يرجى مراجعة هذه المقالة وإزالة وسم المقالات غير المراجعة، ووسمها بوسوم الصيانة المناسبة.

تريبتوفان (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
N write.svg
هذه مقالة جديدة غير مراجعة. ينبغي أن يزال هذا القالب بعد أن يراجعها محرر ما عدا الذي أنشأها؛ إذا لزم الأمر فيجب أن توسم المقالة بقوالب الصيانة المناسبة. (أغسطس 2007)
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
L-tryptophan-skeletal.png L-tryptophan-3D-sticks.png
معلومات عامة
Width setter.gif
صيغة كيميائية: C11H11N2O2 
وزن جزيئي: 204.23 غ·مول-1
تسمية IUPAC:
(S)-2-Amino-3-(1H-indol-3-yl)-propanoic acid
مختصرات: W, Trp
لا يوجد
بيانات قاعدة البيانات
SMILES: C(N)(C(=O)O)CC1c2ccccc2NC=1
InChI=1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1/f/h14H 1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
 رمز ATC: غير موجود  CAS: 73-22-3  دروجبانك: غير موجود  رقم EINECS:
200-795-6 [1]
 بوبكيم: 9060 (D)[2], 6305 (L)[3]
خواص فيزيائية
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
تصرف الحالة
خواص الصلب
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -1.677 pI: 5.89 pKa: 2.38, 9.34 تاوتومير: ? رابطة هيدروجينية: متبرع - 3;   مستقبل - 4;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


  1. a  73-22-3 EINECS for Tryptophan
  2. a  بوبكيم 9060
  3. a  بوبكيم 6305