موناتين: الفرق بين النسختين

اذهب إلى التنقل اذهب إلى البحث
أُضيف 1٬222 بايت ، ‏ قبل سنتين
[نسخة منشورة][نسخة منشورة]
{{يتيمة|تاريخ=يونيو 2020}}
| Verifiedfields = changed
{{معلومات كيمياء - خواص|معرف ويكي بيانات=Q754363}}
| Watchedfields = changed
| verifiedrevid = 438855548
| ImageFile = Monatin.png
| ImageSize = 200px
| IUPACName = (2''S'',4''S'')-4-Amino-2-hydroxy-2-(1''H''-indol-3-ylmethyl)-pentanedioic acid
| OtherNames = 2-Hydroxy-2-(indol-3-ylmethyl)-4-aminoglutaric acid<br>(''S'')-4-Hydroxy-4-(1''H''-indol-3-ylmethyl)-<small>L</small>-glutamic acid
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 146142-94-1
| PubChem = 9860847
| SMILES = O[C@]([C@](O)=O)(C[C@H](N)C(O)=O)CC2=CNC1=CC=CC=C12
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8036546
| InChI = 1/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
|Section2={{Chembox Properties
| C=14 | H=16 | N=2 | O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
'''الموناتين''' Monatin والمعروف أيضا باسم أروفا، هو مُحلي طبيعي عالي الكثافة معزول عن نبات Sclerochiton ilicifolius وهو نوع من النباتات المزهرة وتدعى [[مغنولانية]] الموجود في منطقة [[ترانسفال]] في [[جنوب إفريقيا]]. لا يحتوي الموناتين على أي [[كربوهيدرات]] أو [[سكر]]، ولا يحتوي على طاقة غذائية تقريبًا، على عكس السكروز أو المحليات الغذائية الأخرى.<ref>{{US patent application|20050106305}}, Timothy W. Abraham, [[كارجيل (شركة)|]]</ref>

قائمة التصفح