هذه المقالة يتيمة. ساعد بإضافة وصلة إليها في مقالة متعلقة بها

ميثايونين (صفحة بيانات)

من ويكيبيديا، الموسوعة الحرة
اذهب إلى: تصفح، ‏ ابحث
البيانات الكاملة لل[[{{{wiki name}}}]]
Width setter.gif
L-methionine-skeletal.png L-methionine-3D-sticks.png
معلومات عامة
Width setter.gif
صيغة كيميائية: C5H11NO2S 
وزن جزيئي: 149.21 غ·مول-1
تسمية IUPAC:
(S)2-amino-4-methylsulfanyl-butanoic acid
مختصرات: M, Met
بيانات قاعدة البيانات
InChI=InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/f/h7H (L)
1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/f/h7H (D)
 رمز ATC: غير موجود  CAS: 63-68-3  دروجبانك: غير موجود  رقم EINECS: 200-562-9[1],  بوبكيم: 876 (D) [2], 6137 (L)[3]
خواص فيزيائية
بيانات البلورات
البيانات الطيفية
تحليل الطيف الظاهر بالاشعة فوق البنفسجية
أشعة تحت الحمراء
تصرف الحالة
خواص الصلب
خواص السائل
خواص الغاز
الخواص المؤذية للصحة
MSDS غير موجود الأخطار:
- غير موجود
NFPA 704
NFPA 704.svg
نقطة الوميض
- غير موجود
R/S statement
R: غير موجود
S: غير موجود
رقم RTECS:
غير موجود
الخواص الكيميائية
XLogP: -2.308 pI: 5.74 pKa: 2.16, 9.08 تاوتومير: ? رابطة هيدروجينية: متبرع - 2;   مستقبل - 3;
الخواص الصيدلية
ما عدا عندما يتم ذكره، البيانات المتواجدة هنا هي للمواد في الحالة القياسية (درجة حرارة 25 °C، وضغط 100 كيلوباسكال)


  1. a  63-68-3 EINECS for L-Methionine
  2. a  بوبكيم 876
  3. a  بوبكيم 6137