انتقل إلى المحتوى

ميناديون: الفرق بين النسختين

من ويكيبيديا، الموسوعة الحرة
[مراجعة غير مفحوصة][مراجعة غير مفحوصة]
تم حذف المحتوى تمت إضافة المحتوى
JarBot (نقاش | مساهمات)
ط بوت: تصنيف التحويلات
أزال التحويلة إلى فيتامين ك
وسم: أزال التحويلة
سطر 1: سطر 1:
{{chembox
#تحويل [[فيتامين ك]]
| Verifiedfields = changed
{{تحويلة طب}}
| Watchedfields = changed
| Reference =<ref>''[[The Merck Index]]'', 11th Edition, '''5714'''</ref>
| verifiedrevid = 411385075
| ImageFile = Menadione.svg
| ImageSize = 140
| ImageName = Skeltal formula
| ImageFile1 = Menadione-3D-balls.png
| ImageSize1 = 140
| ImageName1 = Ball-and-stick model
| IUPACName = 2-Methylnaphthalene-1,4-dione
| OtherNames = Menaphthone; Vitamin K<sub>3</sub>; β-Methyl-1,4-naphthoquinone; 2-Methyl-1,4-naphthodione; 2-Methyl-1,4-naphthoquinone
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3915
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 590
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 723JX6CXY5
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02335
| InChI = 1/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3
| InChIKey = MJVAVZPDRWSRRC-UHFFFAOYAY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MJVAVZPDRWSRRC-UHFFFAOYSA-N
| CASNo =58-27-5
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem =4055
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00170
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 28869
| SMILES = O=C\2c1c(cccc1)C(=O)/C(=C/2)C
}}
|Section2={{Chembox Properties
| C=11 | H=8 | O=2
| Appearance =Bright yellow crystals
| Density =1.225g/cm3
| MeltingPtC = 105 to 107
| MeltingPt_notes =
| BoilingPtC = 304.5
| BoilingPt_notes = @ 760mmHg
| Solubility =Insoluble
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = B02
| ATCCode_suffix = BA02
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPtC = 113.8
| AutoignitionPtC =
| LD50 = 0.5 g/kg (oral, mouse)
}}
}}
'''ميناديون''' هو [[مركب عضوي]] تركيبته C6H4(CO)2C2H(CH3). ميناديون [[مشابه بنيوي]] ل[[4،1-نفثوكينون]] مع مجموعة [[ميثيل]] في الموقع الثاني.<ref name="pmid19098979">{{cite journal |author=Castro FA, Mariani D, Panek AD, Eleutherio EC, Pereira MD |title=Cytotoxicity Mechanism of Two Naphthoquinones (Menadione and Plumbagin) in Saccharomyces cerevisiae |journal=PLoS ONE |volume=3 |issue=12 |pages=e3999 |year=2008 |pmid=19098979 |pmc=2600608 |doi=10.1371/journal.pone.0003999 |url=http://www.plosone.org/article/info:doi/10.1371/journal.pone.0003999 |editor1-last=Fox |editor1-first=Debbie}}</ref> يستعمل أحيانا في [[المكملات الغذائية]] بسبب امتلاكه لفعالية [[فيتامين ك]].

يسمى عادة باسم فيتامين ك<sub>3</sub>.<ref name="pmid15939799">{{cite journal |vauthors=Scott GK, Atsriku C, Kaminker P, etal |title=Vitamin K3 (menadione)-induced oncosis associated with keratin 8 phosphorylation and histone H3 arylation |journal=Mol. Pharmacol. |volume=68 |issue=3 |pages=606–15 |date=September 2005 |pmid=15939799 |doi=10.1124/mol.105.013474 |url=http://molpharm.aspetjournals.org/cgi/pmidlookup?view=long&pmid=15939799}}</ref>

==المصادر==
{{مراجع}}

{{مانعات النزف}}

[[تصنيف:فيتامينات]]
[[تصنيف:4،1-نفثوكينونات]]

نسخة 21:09، 12 فبراير 2018

ميناديون[1]
ميناديون
ميناديون

ميناديون
ميناديون

الاسم النظامي (IUPAC)

2-Methylnaphthalene-1,4-dione

أسماء أخرى

Menaphthone; Vitamin K3; β-Methyl-1,4-naphthoquinone; 2-Methyl-1,4-naphthodione; 2-Methyl-1,4-naphthoquinone

المعرفات
رقم CAS 58-27-5 ☑Y
بوب كيم (PubChem) 4055
مواصفات الإدخال النصي المبسط للجزيئات
  • O=C\2c1c(cccc1)C(=O)/C(=C/2)C

  • 1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 ☑Y
    Key: MJVAVZPDRWSRRC-UHFFFAOYSA-N ☑Y

الخواص
صيغة كيميائية C11H8O2
كتلة مولية 172.18 غ.مول−1
المظهر Bright yellow crystals
الكثافة 1.225g/cm3
نقطة الانصهار 105 to 107 °س، خطأ في التعبير: كلمة لم نتعرف عليها «to». °ك، خطأ في التعبير: كلمة لم نتعرف عليها «to». °ف
نقطة الغليان 304.5 °س، 578 °ك، 580 °ف
الذوبانية في الماء Insoluble
كود ATC B02BA02
المخاطر
LD50 0.5 g/kg (oral, mouse)
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

ميناديون هو مركب عضوي تركيبته C6H4(CO)2C2H(CH3). ميناديون مشابه بنيوي ل4،1-نفثوكينون مع مجموعة ميثيل في الموقع الثاني.[2] يستعمل أحيانا في المكملات الغذائية بسبب امتلاكه لفعالية فيتامين ك.

يسمى عادة باسم فيتامين ك3.[3]

المصادر

  1. ^ The Merck Index, 11th Edition, 5714
  2. ^ Castro FA, Mariani D, Panek AD, Eleutherio EC, Pereira MD (2008). Fox، Debbie (المحرر). "Cytotoxicity Mechanism of Two Naphthoquinones (Menadione and Plumbagin) in Saccharomyces cerevisiae". PLoS ONE. ج. 3 ع. 12: e3999. DOI:10.1371/journal.pone.0003999. PMC:2600608. PMID:19098979.{{استشهاد بدورية محكمة}}: صيانة الاستشهاد: أسماء متعددة: قائمة المؤلفين (link) صيانة الاستشهاد: دوي مجاني غير معلم (link)
  3. ^ Scott GK، Atsriku C، Kaminker P، وآخرون (سبتمبر 2005). "Vitamin K3 (menadione)-induced oncosis associated with keratin 8 phosphorylation and histone H3 arylation". Mol. Pharmacol. ج. 68 ع. 3: 606–15. DOI:10.1124/mol.105.013474. PMID:15939799.